About [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone
[4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone (PubChem CID 53172793) has the molecular formula C18H18N4OS2
and a molecular weight of 370.50 g/mol. Its IUPAC name is [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone |
| PubChem CID | 53172793 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone |
| SMILES | Cc1csc(-c2ccc(N3CCN(C(=O)c4ccsc4)CC3)nc2)n1 |
| InChI | InChI=1S/C18H18N4OS2/c1-13-11-25-17(20-13)14-2-3-16(19-10-14)21-5-7-22(8-6-21)18(23)15-4-9-24-12-15/h2-4,9-12H,5-8H2,1H3 |
| InChIKey | ZVWXAJCGVJUPQT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone?
The IUPAC name of [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone (CID 53172793) is [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone.
What is the SMILES notation for [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone?
The canonical SMILES for [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone is Cc1csc(-c2ccc(N3CCN(C(=O)c4ccsc4)CC3)nc2)n1.
What is the InChIKey of [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone?
The InChIKey is ZVWXAJCGVJUPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4OS2/c1-13-11-25-17(20-13)14-2-3-16(19-10-14)21-5-7-22(8-6-21)18(23)15-4-9-24-12-15/h2-4,9-12H,5-8H2,1H3.
What are the key properties of [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone?
[4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone has a molecular weight of 370.50 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(4-methyl-1,3-thiazol-2-yl)-2-pyridinyl]piperazin-1-yl]-thiophen-3-ylmethanone is sourced from PubChem (CID 53172793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).