C15H24 — CID 5317320
(3Z,6Z)-3,7,11-trimethyldodeca-1,3,6,10-tetraene (PubChem CID 5317320) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (3Z,6Z)-3,7,11-trimethyldodeca-1,3,6,10-tetraene.
| Compound Name | (3Z,6Z)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
|---|---|
| PubChem CID | 5317320 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (3Z,6Z)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
| SMILES | C=C/C(C)=C\C/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10-,15-12- |
| InChIKey | CXENHBSYCFFKJS-LOQWIJHWSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|