C15H16O6 — CID 5317353
methyl (1R,4aS,7R,7aS)-4'-ethyl-1-hydroxy-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate (PubChem CID 5317353) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl (1R,4aS,7R,7aS)-4'-ethyl-1-hydroxy-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate.
| Compound Name | methyl (1R,4aS,7R,7aS)-4'-ethyl-1-hydroxy-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
|---|---|
| PubChem CID | 5317353 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | methyl (1R,4aS,7R,7aS)-4'-ethyl-1-hydroxy-5'-oxospiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
| SMILES | CCC1=C[C@@]2(C=C[C@@H]3C(C(=O)OC)=CO[C@@H](O)[C@@H]32)OC1=O |
| InChI | InChI=1S/C15H16O6/c1-3-8-6-15(21-12(8)16)5-4-9-10(13(17)19-2)7-20-14(18)11(9)15/h4-7,9,11,14,18H,3H2,1-2H3/t9-,11-,14-,15-/m1/s1 |
| InChIKey | IPOOVYQKBQYNQY-NZQZLILVSA-N |
| XLogP | 0.83 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|