C19H33N5O — CID 53174251
N-butan-2-yl-3-[1-[6-(propylamino)pyrimidin-4-yl]piperidin-3-yl]propanamide (PubChem CID 53174251) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is N-butan-2-yl-3-[1-[6-(propylamino)pyrimidin-4-yl]piperidin-3-yl]propanamide.
| Compound Name | N-butan-2-yl-3-[1-[6-(propylamino)pyrimidin-4-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 53174251 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | N-butan-2-yl-3-[1-[6-(propylamino)pyrimidin-4-yl]piperidin-3-yl]propanamide |
| SMILES | CCCNc1cc(N2CCCC(CCC(=O)NC(C)CC)C2)ncn1 |
| InChI | InChI=1S/C19H33N5O/c1-4-10-20-17-12-18(22-14-21-17)24-11-6-7-16(13-24)8-9-19(25)23-15(3)5-2/h12,14-16H,4-11,13H2,1-3H3,(H,23,25)(H,20,21,22) |
| InChIKey | NJMOLTFLYDORSS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |