C19H31N5O — CID 53174507
3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]-N-(2-methylpropyl)propanamide (PubChem CID 53174507) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]-N-(2-methylpropyl)propanamide.
| Compound Name | 3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 53174507 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-3-yl]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)CCC1CCCN(c2cc(NC3CC3)ncn2)C1 |
| InChI | InChI=1S/C19H31N5O/c1-14(2)11-20-19(25)8-5-15-4-3-9-24(12-15)18-10-17(21-13-22-18)23-16-6-7-16/h10,13-16H,3-9,11-12H2,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | DVUPPLDBPOZJQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |