About 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol
8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol (PubChem CID 5317559) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol.
Molecular Properties
| Compound Name | 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol |
| PubChem CID | 5317559 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol |
| SMILES | Cc1nccc2c1C(O)OCC2 |
| InChI | InChI=1S/C9H11NO2/c1-6-8-7(2-4-10-6)3-5-12-9(8)11/h2,4,9,11H,3,5H2,1H3 |
| InChIKey | HCBOYQSYWSEVID-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol?
The IUPAC name of 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol (CID 5317559) is 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol.
What is the SMILES notation for 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol?
The canonical SMILES for 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol is Cc1nccc2c1C(O)OCC2.
What is the InChIKey of 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol?
The InChIKey is HCBOYQSYWSEVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-8-7(2-4-10-6)3-5-12-9(8)11/h2,4,9,11H,3,5H2,1H3.
What are the key properties of 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol?
8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol has a molecular weight of 165.19 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-ol is sourced from PubChem (CID 5317559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).