About (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone
(4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone (PubChem CID 53176321) has the molecular formula C19H15FN2O2
and a molecular weight of 322.34 g/mol. Its IUPAC name is (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone.
Molecular Properties
| Compound Name | (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone |
| PubChem CID | 53176321 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone |
| SMILES | Cc1cc(-c2ccc3c(c2)CCN3C(=O)c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C19H15FN2O2/c1-12-10-18(24-21-12)15-4-7-17-14(11-15)8-9-22(17)19(23)13-2-5-16(20)6-3-13/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | WYXQIQLQIXJYCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone?
The IUPAC name of (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone (CID 53176321) is (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone.
What is the SMILES notation for (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone?
The canonical SMILES for (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone is Cc1cc(-c2ccc3c(c2)CCN3C(=O)c2ccc(F)cc2)on1.
What is the InChIKey of (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone?
The InChIKey is WYXQIQLQIXJYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN2O2/c1-12-10-18(24-21-12)15-4-7-17-14(11-15)8-9-22(17)19(23)13-2-5-16(20)6-3-13/h2-7,10-11H,8-9H2,1H3.
What are the key properties of (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone?
(4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone has a molecular weight of 322.34 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)-[5-(3-methyl-1,2-oxazol-5-yl)-2,3-dihydroindol-1-yl]methanone is sourced from PubChem (CID 53176321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).