About 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one
7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one (PubChem CID 5317652) has the molecular formula C20H16O5
and a molecular weight of 336.34 g/mol. Its IUPAC name is 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one.
Molecular Properties
| Compound Name | 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one |
| PubChem CID | 5317652 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one |
| SMILES | CC1(C)C=Cc2c(ccc(-c3coc4cc(O)ccc4c3=O)c2O)O1 |
| InChI | InChI=1S/C20H16O5/c1-20(2)8-7-14-16(25-20)6-5-12(18(14)22)15-10-24-17-9-11(21)3-4-13(17)19(15)23/h3-10,21-22H,1-2H3 |
| InChIKey | COLMVFWKLOZOOP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one?
The IUPAC name of 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one (CID 5317652) is 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one.
What is the SMILES notation for 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one?
The canonical SMILES for 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one is CC1(C)C=Cc2c(ccc(-c3coc4cc(O)ccc4c3=O)c2O)O1.
What is the InChIKey of 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one?
The InChIKey is COLMVFWKLOZOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O5/c1-20(2)8-7-14-16(25-20)6-5-12(18(14)22)15-10-24-17-9-11(21)3-4-13(17)19(15)23/h3-10,21-22H,1-2H3.
What are the key properties of 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one?
7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one has a molecular weight of 336.34 g/mol, XLogP of 4.06, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one is sourced from PubChem (CID 5317652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).