C15H22O2 — CID 5317842
6-methyl-9-prop-1-en-2-yl-3-oxatricyclo[5.4.1.04,12]dodecan-2-one (PubChem CID 5317842) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 6-methyl-9-prop-1-en-2-yl-3-oxatricyclo[5.4.1.04,12]dodecan-2-one.
| Compound Name | 6-methyl-9-prop-1-en-2-yl-3-oxatricyclo[5.4.1.04,12]dodecan-2-one |
|---|---|
| PubChem CID | 5317842 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 6-methyl-9-prop-1-en-2-yl-3-oxatricyclo[5.4.1.04,12]dodecan-2-one |
| SMILES | C=C(C)C1CCC2C(=O)OC3CC(C)C(C1)C32 |
| InChI | InChI=1S/C15H22O2/c1-8(2)10-4-5-11-14-12(7-10)9(3)6-13(14)17-15(11)16/h9-14H,1,4-7H2,2-3H3 |
| InChIKey | RDYUBCVSUYWYDA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|