About [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone
[5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone (PubChem CID 53179842) has the molecular formula C19H16N2O2S
and a molecular weight of 336.42 g/mol. Its IUPAC name is [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone.
Molecular Properties
| Compound Name | [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone |
| PubChem CID | 53179842 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCc2cc(-c3csc(C4CC4)n3)ccc21 |
| InChI | InChI=1S/C19H16N2O2S/c22-19(15-6-8-23-10-15)21-7-5-14-9-13(3-4-17(14)21)16-11-24-18(20-16)12-1-2-12/h3-4,6,8-12H,1-2,5,7H2 |
| InChIKey | QBNJSDAXOPYWIH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone?
The IUPAC name of [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone (CID 53179842) is [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone.
What is the SMILES notation for [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone?
The canonical SMILES for [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone is O=C(c1ccoc1)N1CCc2cc(-c3csc(C4CC4)n3)ccc21.
What is the InChIKey of [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone?
The InChIKey is QBNJSDAXOPYWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2S/c22-19(15-6-8-23-10-15)21-7-5-14-9-13(3-4-17(14)21)16-11-24-18(20-16)12-1-2-12/h3-4,6,8-12H,1-2,5,7H2.
What are the key properties of [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone?
[5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone has a molecular weight of 336.42 g/mol, XLogP of 4.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-cyclopropyl-1,3-thiazol-4-yl)-2,3-dihydroindol-1-yl]-(furan-3-yl)methanone is sourced from PubChem (CID 53179842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).