About heptadec-1-en-4,6-diyne-3,9-diol
heptadec-1-en-4,6-diyne-3,9-diol (PubChem CID 5318011) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is heptadec-1-en-4,6-diyne-3,9-diol.
Molecular Properties
| Compound Name | heptadec-1-en-4,6-diyne-3,9-diol |
| PubChem CID | 5318011 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | heptadec-1-en-4,6-diyne-3,9-diol |
| SMILES | C=CC(O)C#CC#CCC(O)CCCCCCCC |
| InChI | InChI=1S/C17H26O2/c1-3-5-6-7-8-10-14-17(19)15-12-9-11-13-16(18)4-2/h4,16-19H,2-3,5-8,10,14-15H2,1H3 |
| InChIKey | WNSUMUNACHNURC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze heptadec-1-en-4,6-diyne-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadec-1-en-4,6-diyne-3,9-diol?
The IUPAC name of heptadec-1-en-4,6-diyne-3,9-diol (CID 5318011) is heptadec-1-en-4,6-diyne-3,9-diol.
What is the SMILES notation for heptadec-1-en-4,6-diyne-3,9-diol?
The canonical SMILES for heptadec-1-en-4,6-diyne-3,9-diol is C=CC(O)C#CC#CCC(O)CCCCCCCC.
What is the InChIKey of heptadec-1-en-4,6-diyne-3,9-diol?
The InChIKey is WNSUMUNACHNURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-3-5-6-7-8-10-14-17(19)15-12-9-11-13-16(18)4-2/h4,16-19H,2-3,5-8,10,14-15H2,1H3.
What are the key properties of heptadec-1-en-4,6-diyne-3,9-diol?
heptadec-1-en-4,6-diyne-3,9-diol has a molecular weight of 262.39 g/mol, XLogP of 3.04, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptadec-1-en-4,6-diyne-3,9-diol is sourced from PubChem (CID 5318011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).