C20H25ClN2O3 — CID 53180160
2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(3,4-dimethoxyphenyl)ethanol (PubChem CID 53180160) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(3,4-dimethoxyphenyl)ethanol.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 53180160 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1-(3,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)CN2CCN(c3cccc(Cl)c3)CC2)cc1OC |
| InChI | InChI=1S/C20H25ClN2O3/c1-25-19-7-6-15(12-20(19)26-2)18(24)14-22-8-10-23(11-9-22)17-5-3-4-16(21)13-17/h3-7,12-13,18,24H,8-11,14H2,1-2H3 |
| InChIKey | RWHDPWHPPMIWFV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |