C21H28N2O3 — CID 53180201
1-(2,5-dimethoxyphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]ethanol (PubChem CID 53180201) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]ethanol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 53180201 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]ethanol |
| SMILES | COc1ccc(OC)c(C(O)CN2CCN(c3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-16-4-6-17(7-5-16)23-12-10-22(11-13-23)15-20(24)19-14-18(25-2)8-9-21(19)26-3/h4-9,14,20,24H,10-13,15H2,1-3H3 |
| InChIKey | USALYRYXTVYVFZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|