C16H29NO — CID 5318023
(2E,8E)-N-(2-methylpropyl)dodeca-2,8-dienamide (PubChem CID 5318023) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (2E,8E)-N-(2-methylpropyl)dodeca-2,8-dienamide.
| Compound Name | (2E,8E)-N-(2-methylpropyl)dodeca-2,8-dienamide |
|---|---|
| PubChem CID | 5318023 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (2E,8E)-N-(2-methylpropyl)dodeca-2,8-dienamide |
| SMILES | CCC/C=C/CCCC/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C16H29NO/c1-4-5-6-7-8-9-10-11-12-13-16(18)17-14-15(2)3/h6-7,12-13,15H,4-5,8-11,14H2,1-3H3,(H,17,18)/b7-6+,13-12+ |
| InChIKey | JNPRQUIWDVDHIT-GYIPPJPDSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|