C23H25N3O3 — CID 53180365
N-(1-benzylpiperidin-4-yl)-2-(2-oxo-5-phenyl-1,3-oxazol-3-yl)acetamide (PubChem CID 53180365) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(2-oxo-5-phenyl-1,3-oxazol-3-yl)acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(2-oxo-5-phenyl-1,3-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 53180365 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(2-oxo-5-phenyl-1,3-oxazol-3-yl)acetamide |
| SMILES | O=C(Cn1cc(-c2ccccc2)oc1=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O3/c27-22(17-26-16-21(29-23(26)28)19-9-5-2-6-10-19)24-20-11-13-25(14-12-20)15-18-7-3-1-4-8-18/h1-10,16,20H,11-15,17H2,(H,24,27) |
| InChIKey | CQHXIJFZMFCWTM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |