About N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide
N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide (PubChem CID 53180580) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide |
| PubChem CID | 53180580 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide |
| SMILES | Cc1ccc(-c2cn(CC(=O)Nc3cccc(C)c3C)c(=O)o2)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-13-7-9-16(10-8-13)18-11-22(20(24)25-18)12-19(23)21-17-6-4-5-14(2)15(17)3/h4-11H,12H2,1-3H3,(H,21,23) |
| InChIKey | KETDCDIDXPCOIW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide?
The IUPAC name of N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide (CID 53180580) is N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide.
What is the SMILES notation for N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide?
The canonical SMILES for N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide is Cc1ccc(-c2cn(CC(=O)Nc3cccc(C)c3C)c(=O)o2)cc1.
What is the InChIKey of N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide?
The InChIKey is KETDCDIDXPCOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3/c1-13-7-9-16(10-8-13)18-11-22(20(24)25-18)12-19(23)21-17-6-4-5-14(2)15(17)3/h4-11H,12H2,1-3H3,(H,21,23).
What are the key properties of N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide?
N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide has a molecular weight of 336.39 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethylphenyl)-2-[5-(4-methylphenyl)-2-oxo-1,3-oxazol-3-yl]acetamide is sourced from PubChem (CID 53180580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).