C20H15N3O2 — CID 5318147
19-ethenyl-7-hydroxy-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15(20),16,18-octaen-14-one (PubChem CID 5318147) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 19-ethenyl-7-hydroxy-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15(20),16,18-octaen-14-one.
| Compound Name | 19-ethenyl-7-hydroxy-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15(20),16,18-octaen-14-one |
|---|---|
| PubChem CID | 5318147 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 19-ethenyl-7-hydroxy-3,13,17-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15(20),16,18-octaen-14-one |
| SMILES | C=Cc1cncc2c(=O)n3c(cc12)-c1[nH]c2ccc(O)cc2c1CC3 |
| InChI | InChI=1S/C20H15N3O2/c1-2-11-9-21-10-16-14(11)8-18-19-13(5-6-23(18)20(16)25)15-7-12(24)3-4-17(15)22-19/h2-4,7-10,22,24H,1,5-6H2 |
| InChIKey | OMUZOORUXOSLTN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|