About N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide
N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide (PubChem CID 53181681) has the molecular formula C19H26N4O3S
and a molecular weight of 390.51 g/mol. Its IUPAC name is N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide |
| PubChem CID | 53181681 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCc2ccccc2)c(C)n1C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H26N4O3S/c1-14-18(19(24)20-13-16-7-5-4-6-8-16)21-15(2)23(14)17-9-11-22(12-10-17)27(3,25)26/h4-8,17H,9-13H2,1-3H3,(H,20,24) |
| InChIKey | KIOAWZFPPUKQGN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide?
The IUPAC name of N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide (CID 53181681) is N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide.
What is the SMILES notation for N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide?
The canonical SMILES for N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide is Cc1nc(C(=O)NCc2ccccc2)c(C)n1C1CCN(S(C)(=O)=O)CC1.
What is the InChIKey of N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide?
The InChIKey is KIOAWZFPPUKQGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O3S/c1-14-18(19(24)20-13-16-7-5-4-6-8-16)21-15(2)23(14)17-9-11-22(12-10-17)27(3,25)26/h4-8,17H,9-13H2,1-3H3,(H,20,24).
What are the key properties of N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide?
N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide has a molecular weight of 390.51 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,5-dimethyl-1-(1-methylsulfonylpiperidin-4-yl)imidazole-4-carboxamide is sourced from PubChem (CID 53181681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).