C25H31N3O2 — CID 53181864
N-(1-benzylpiperidin-4-yl)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 53181864) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 53181864 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)C1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C25H31N3O2/c29-24-17-22(19-28(24)16-11-20-7-3-1-4-8-20)25(30)26-23-12-14-27(15-13-23)18-21-9-5-2-6-10-21/h1-10,22-23H,11-19H2,(H,26,30) |
| InChIKey | WRUIRRNXRDGFFO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |