C20H27N3O2 — CID 53181926
N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]-2-phenylbutanamide (PubChem CID 53181926) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]-2-phenylbutanamide.
| Compound Name | N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 53181926 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]-2-phenylbutanamide |
| SMILES | CCc1noc(C2(NC(=O)C(CC)c3ccccc3)CCCCC2)n1 |
| InChI | InChI=1S/C20H27N3O2/c1-3-16(15-11-7-5-8-12-15)18(24)22-20(13-9-6-10-14-20)19-21-17(4-2)23-25-19/h5,7-8,11-12,16H,3-4,6,9-10,13-14H2,1-2H3,(H,22,24) |
| InChIKey | SQNRSNYIAXRMCG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |