About 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide
3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide (PubChem CID 53181990) has the molecular formula C17H20ClN3O2
and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide |
| PubChem CID | 53181990 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide |
| SMILES | CCc1noc(C2(NC(=O)c3cccc(Cl)c3)CCCCC2)n1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-2-14-19-16(23-21-14)17(9-4-3-5-10-17)20-15(22)12-7-6-8-13(18)11-12/h6-8,11H,2-5,9-10H2,1H3,(H,20,22) |
| InChIKey | NDPIGYJZTRTBGY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide?
The IUPAC name of 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide (CID 53181990) is 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide.
What is the SMILES notation for 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide?
The canonical SMILES for 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide is CCc1noc(C2(NC(=O)c3cccc(Cl)c3)CCCCC2)n1.
What is the InChIKey of 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide?
The InChIKey is NDPIGYJZTRTBGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O2/c1-2-14-19-16(23-21-14)17(9-4-3-5-10-17)20-15(22)12-7-6-8-13(18)11-12/h6-8,11H,2-5,9-10H2,1H3,(H,20,22).
What are the key properties of 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide?
3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide has a molecular weight of 333.82 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide is sourced from PubChem (CID 53181990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).