C17H20ClN3O2 — CID 53181991
2-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide (PubChem CID 53181991) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide.
| Compound Name | 2-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 53181991 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-chloro-N-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclohexyl]benzamide |
| SMILES | CCc1noc(C2(NC(=O)c3ccccc3Cl)CCCCC2)n1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-2-14-19-16(23-21-14)17(10-6-3-7-11-17)20-15(22)12-8-4-5-9-13(12)18/h4-5,8-9H,2-3,6-7,10-11H2,1H3,(H,20,22) |
| InChIKey | SMUAZBRLGZKIDM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |