C17H21N3O3S — CID 53182791
N-ethyl-N-(3-methylphenyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-sulfonamide (PubChem CID 53182791) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-ethyl-N-(3-methylphenyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-sulfonamide.
| Compound Name | N-ethyl-N-(3-methylphenyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-sulfonamide |
|---|---|
| PubChem CID | 53182791 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-ethyl-N-(3-methylphenyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-sulfonamide |
| SMILES | CCN(c1cccc(C)c1)S(=O)(=O)c1cc2n(c1)CCCNC2=O |
| InChI | InChI=1S/C17H21N3O3S/c1-3-20(14-7-4-6-13(2)10-14)24(22,23)15-11-16-17(21)18-8-5-9-19(16)12-15/h4,6-7,10-12H,3,5,8-9H2,1-2H3,(H,18,21) |
| InChIKey | WIBQLOINTLSMKT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |