About 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one
4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one (PubChem CID 53183298) has the molecular formula C17H19N3O2
and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one |
| PubChem CID | 53183298 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one |
| SMILES | O=C1CC(c2noc(C3CCCC3)n2)CN1c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c21-15-10-13(11-20(15)14-8-2-1-3-9-14)16-18-17(22-19-16)12-6-4-5-7-12/h1-3,8-9,12-13H,4-7,10-11H2 |
| InChIKey | PUWAYOGMHMZZCQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one?
The IUPAC name of 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one (CID 53183298) is 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one.
What is the SMILES notation for 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one?
The canonical SMILES for 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one is O=C1CC(c2noc(C3CCCC3)n2)CN1c1ccccc1.
What is the InChIKey of 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one?
The InChIKey is PUWAYOGMHMZZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O2/c21-15-10-13(11-20(15)14-8-2-1-3-9-14)16-18-17(22-19-16)12-6-4-5-7-12/h1-3,8-9,12-13H,4-7,10-11H2.
What are the key properties of 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one?
4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one has a molecular weight of 297.36 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-1-phenylpyrrolidin-2-one is sourced from PubChem (CID 53183298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).