About [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone
[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone (PubChem CID 53183369) has the molecular formula C17H14FN3O2
and a molecular weight of 311.32 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone |
| PubChem CID | 53183369 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCCn2cc(-c3ccccc3F)nc21 |
| InChI | InChI=1S/C17H14FN3O2/c18-13-6-2-1-5-12(13)14-11-20-8-4-9-21(17(20)19-14)16(22)15-7-3-10-23-15/h1-3,5-7,10-11H,4,8-9H2 |
| InChIKey | GWZLDLJCDSZDOT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone?
The IUPAC name of [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone (CID 53183369) is [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone.
What is the SMILES notation for [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone?
The canonical SMILES for [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone is O=C(c1ccco1)N1CCCn2cc(-c3ccccc3F)nc21.
What is the InChIKey of [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone?
The InChIKey is GWZLDLJCDSZDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FN3O2/c18-13-6-2-1-5-12(13)14-11-20-8-4-9-21(17(20)19-14)16(22)15-7-3-10-23-15/h1-3,5-7,10-11H,4,8-9H2.
What are the key properties of [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone?
[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone has a molecular weight of 311.32 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-(furan-2-yl)methanone is sourced from PubChem (CID 53183369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).