About 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone
1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone (PubChem CID 53183373) has the molecular formula C18H16FN3OS
and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone.
Molecular Properties
| Compound Name | 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone |
| PubChem CID | 53183373 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCCn2cc(-c3ccccc3F)nc21 |
| InChI | InChI=1S/C18H16FN3OS/c19-15-5-2-1-4-14(15)16-11-21-7-3-8-22(18(21)20-16)17(23)10-13-6-9-24-12-13/h1-2,4-6,9,11-12H,3,7-8,10H2 |
| InChIKey | MEMPWQSIVHTOJA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone?
The IUPAC name of 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone (CID 53183373) is 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone.
What is the SMILES notation for 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone?
The canonical SMILES for 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone is O=C(Cc1ccsc1)N1CCCn2cc(-c3ccccc3F)nc21.
What is the InChIKey of 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone?
The InChIKey is MEMPWQSIVHTOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3OS/c19-15-5-2-1-4-14(15)16-11-21-7-3-8-22(18(21)20-16)17(23)10-13-6-9-24-12-13/h1-2,4-6,9,11-12H,3,7-8,10H2.
What are the key properties of 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone?
1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone has a molecular weight of 341.41 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-fluorophenyl)-6,7-dihydro-5H-imidazo[1,2-a]pyrimidin-8-yl]-2-thiophen-3-ylethanone is sourced from PubChem (CID 53183373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).