C21H22N2O3 — CID 5318347
(14Z)-6-hydroxy-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2(7),3,5,11-tetraen-9-one (PubChem CID 5318347) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (14Z)-6-hydroxy-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2(7),3,5,11-tetraen-9-one.
| Compound Name | (14Z)-6-hydroxy-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2(7),3,5,11-tetraen-9-one |
|---|---|
| PubChem CID | 5318347 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (14Z)-6-hydroxy-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2(7),3,5,11-tetraen-9-one |
| SMILES | O=C1CC=C2C3CC4N(CCC45c4cccc(O)c4N1C25)C/C3=C\CO |
| InChI | InChI=1S/C21H22N2O3/c24-9-6-12-11-22-8-7-21-15-2-1-3-16(25)19(15)23-18(26)5-4-13(20(21)23)14(12)10-17(21)22/h1-4,6,14,17,20,24-25H,5,7-11H2/b12-6+ |
| InChIKey | DWQGMXJAYLDQTG-WUXMJOGZSA-N |
| XLogP | 1.70 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|