C17H17N5O2S — CID 53183837
N-(4-methylsulfanylphenyl)-8-oxo-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-carboxamide (PubChem CID 53183837) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-8-oxo-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-8-oxo-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-carboxamide |
|---|---|
| PubChem CID | 53183837 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-8-oxo-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-carboxamide |
| SMILES | CSc1ccc(NC(=O)N2CCc3c(nc4cc[nH]n4c3=O)C2)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c1-25-12-4-2-11(3-5-12)19-17(24)21-9-7-13-14(10-21)20-15-6-8-18-22(15)16(13)23/h2-6,8,18H,7,9-10H2,1H3,(H,19,24) |
| InChIKey | KBGCSDBBLVRYNG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |