C18H18N4O3S — CID 53183857
12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183857) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183857 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 12-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc[nH]n13)CN(S(=O)(=O)c1ccc3c(c1)CCC3)CC2 |
| InChI | InChI=1S/C18H18N4O3S/c23-18-15-7-9-21(11-16(15)20-17-6-8-19-22(17)18)26(24,25)14-5-4-12-2-1-3-13(12)10-14/h4-6,8,10,19H,1-3,7,9,11H2 |
| InChIKey | CMWGTGMTTZWGPG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |