C21H15F3N4O2S — CID 53183875
5-phenyl-12-[5-(trifluoromethyl)thiophene-2-carbonyl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183875) has the molecular formula C21H15F3N4O2S and a molecular weight of 444.44 g/mol. Its IUPAC name is 5-phenyl-12-[5-(trifluoromethyl)thiophene-2-carbonyl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-phenyl-12-[5-(trifluoromethyl)thiophene-2-carbonyl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183875 |
| Molecular Formula | C21H15F3N4O2S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 5-phenyl-12-[5-(trifluoromethyl)thiophene-2-carbonyl]-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=C(c1ccc(C(F)(F)F)s1)N1CCc2c(nc3cc(-c4ccccc4)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C21H15F3N4O2S/c22-21(23,24)17-7-6-16(31-17)20(30)27-9-8-13-15(11-27)25-18-10-14(26-28(18)19(13)29)12-4-2-1-3-5-12/h1-7,10,26H,8-9,11H2 |
| InChIKey | JFRQVCOYJDZCJR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |