C24H22N4O2S — CID 53183876
5-phenyl-12-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183876) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 5-phenyl-12-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-phenyl-12-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183876 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 5-phenyl-12-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=C(c1cc2c(s1)CCCC2)N1CCc2c(nc3cc(-c4ccccc4)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C24H22N4O2S/c29-23-17-10-11-27(24(30)21-12-16-8-4-5-9-20(16)31-21)14-19(17)25-22-13-18(26-28(22)23)15-6-2-1-3-7-15/h1-3,6-7,12-13,26H,4-5,8-11,14H2 |
| InChIKey | LOIKVWOTTQMVJJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |