C19H16N4O3S2 — CID 53183896
5-phenyl-12-thiophen-2-ylsulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183896) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 5-phenyl-12-thiophen-2-ylsulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-phenyl-12-thiophen-2-ylsulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183896 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 5-phenyl-12-thiophen-2-ylsulfonyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc(-c4ccccc4)[nH]n13)CN(S(=O)(=O)c1cccs1)CC2 |
| InChI | InChI=1S/C19H16N4O3S2/c24-19-14-8-9-22(28(25,26)18-7-4-10-27-18)12-16(14)20-17-11-15(21-23(17)19)13-5-2-1-3-6-13/h1-7,10-11,21H,8-9,12H2 |
| InChIKey | YJMROQSLZGNRHT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |