C19H21ClN4O3S — CID 53183939
12-butylsulfonyl-5-(2-chlorophenyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183939) has the molecular formula C19H21ClN4O3S and a molecular weight of 420.92 g/mol. Its IUPAC name is 12-butylsulfonyl-5-(2-chlorophenyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-butylsulfonyl-5-(2-chlorophenyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183939 |
| Molecular Formula | C19H21ClN4O3S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 12-butylsulfonyl-5-(2-chlorophenyl)-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCCCS(=O)(=O)N1CCc2c(nc3cc(-c4ccccc4Cl)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C19H21ClN4O3S/c1-2-3-10-28(26,27)23-9-8-14-17(12-23)21-18-11-16(22-24(18)19(14)25)13-6-4-5-7-15(13)20/h4-7,11,22H,2-3,8-10,12H2,1H3 |
| InChIKey | IMMYCYBQRSAHBN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |