C17H15ClN4O2 — CID 53183983
11-[2-(4-chlorophenyl)acetyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183983) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 11-[2-(4-chlorophenyl)acetyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-[2-(4-chlorophenyl)acetyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183983 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 11-[2-(4-chlorophenyl)acetyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCc2nc3cc[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C17H15ClN4O2/c18-12-3-1-11(2-4-12)9-16(23)21-8-6-14-13(10-21)17(24)22-15(20-14)5-7-19-22/h1-5,7,19H,6,8-10H2 |
| InChIKey | SZMQCWMXGHNSGH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |