C14H11ClN4O2S — CID 53183987
11-(5-chlorothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183987) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 11-(5-chlorothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(5-chlorothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183987 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 11-(5-chlorothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=C(c1ccc(Cl)s1)N1CCc2nc3cc[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C14H11ClN4O2S/c15-11-2-1-10(22-11)14(21)18-6-4-9-8(7-18)13(20)19-12(17-9)3-5-16-19/h1-3,5,16H,4,6-7H2 |
| InChIKey | VWJXBTBWEKPTFS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |