C18H18N4O2S — CID 53183998
11-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183998) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 11-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183998 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 11-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=C(c1cc2c(s1)CCCC2)N1CCc2nc3cc[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C18H18N4O2S/c23-17-12-10-21(8-6-13(12)20-16-5-7-19-22(16)17)18(24)15-9-11-3-1-2-4-14(11)25-15/h5,7,9,19H,1-4,6,8,10H2 |
| InChIKey | DQPKBVLGDMRMKS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |