C24H22N4O3S — CID 53184076
11-(2,3-dihydro-1H-inden-5-ylsulfonyl)-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53184076) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 11-(2,3-dihydro-1H-inden-5-ylsulfonyl)-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(2,3-dihydro-1H-inden-5-ylsulfonyl)-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53184076 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 11-(2,3-dihydro-1H-inden-5-ylsulfonyl)-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | O=c1c2c(nc3cc(-c4ccccc4)[nH]n13)CCN(S(=O)(=O)c1ccc3c(c1)CCC3)C2 |
| InChI | InChI=1S/C24H22N4O3S/c29-24-20-15-27(32(30,31)19-10-9-16-7-4-8-18(16)13-19)12-11-21(20)25-23-14-22(26-28(23)24)17-5-2-1-3-6-17/h1-3,5-6,9-10,13-14,26H,4,7-8,11-12,15H2 |
| InChIKey | KBUONRNWDUPJIP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |