C22H17N5O3S — CID 53184077
3-[(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)sulfonyl]benzonitrile (PubChem CID 53184077) has the molecular formula C22H17N5O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is 3-[(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)sulfonyl]benzonitrile.
| Compound Name | 3-[(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 53184077 |
| Molecular Formula | C22H17N5O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 3-[(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2CCc3nc4cc(-c5ccccc5)[nH]n4c(=O)c3C2)c1 |
| InChI | InChI=1S/C22H17N5O3S/c23-13-15-5-4-8-17(11-15)31(29,30)26-10-9-19-18(14-26)22(28)27-21(24-19)12-20(25-27)16-6-2-1-3-7-16/h1-8,11-12,25H,9-10,14H2 |
| InChIKey | NNLQKTIARCUKNH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |