C19H19ClN4O2 — CID 53184085
5-(2-chlorophenyl)-11-(2-methylpropanoyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53184085) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-11-(2-methylpropanoyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-(2-chlorophenyl)-11-(2-methylpropanoyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53184085 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-(2-chlorophenyl)-11-(2-methylpropanoyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)C(=O)N1CCc2nc3cc(-c4ccccc4Cl)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-11(2)18(25)23-8-7-15-13(10-23)19(26)24-17(21-15)9-16(22-24)12-5-3-4-6-14(12)20/h3-6,9,11,22H,7-8,10H2,1-2H3 |
| InChIKey | JDMKGHRKXFXDPG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |