C20H21ClN4O2 — CID 53184099
5-(2-chlorophenyl)-11-pentanoyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53184099) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-11-pentanoyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-(2-chlorophenyl)-11-pentanoyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53184099 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-(2-chlorophenyl)-11-pentanoyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CCCCC(=O)N1CCc2nc3cc(-c4ccccc4Cl)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C20H21ClN4O2/c1-2-3-8-19(26)24-10-9-16-14(12-24)20(27)25-18(22-16)11-17(23-25)13-6-4-5-7-15(13)21/h4-7,11,23H,2-3,8-10,12H2,1H3 |
| InChIKey | XBAOGPXHVXPXBZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |