C25H21N5O3 — CID 53184128
11-(1H-indole-5-carbonyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53184128) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 11-(1H-indole-5-carbonyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(1H-indole-5-carbonyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53184128 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 11-(1H-indole-5-carbonyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | COc1ccc(-c2cc3nc4c(c(=O)n3[nH]2)CN(C(=O)c2ccc3[nH]ccc3c2)CC4)cc1 |
| InChI | InChI=1S/C25H21N5O3/c1-33-18-5-2-15(3-6-18)22-13-23-27-21-9-11-29(14-19(21)25(32)30(23)28-22)24(31)17-4-7-20-16(12-17)8-10-26-20/h2-8,10,12-13,26,28H,9,11,14H2,1H3 |
| InChIKey | CPSHFDBCDNLZGS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |