About 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one
1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 53184164) has the molecular formula C20H25N5O
and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one |
| PubChem CID | 53184164 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | CC1CN=C2C(N3CCN(C(=O)CCc4ccccc4)CC3)=NC=CN21 |
| InChI | InChI=1S/C20H25N5O/c1-16-15-22-20-19(21-9-10-25(16)20)24-13-11-23(12-14-24)18(26)8-7-17-5-3-2-4-6-17/h2-6,9-10,16H,7-8,11-15H2,1H3 |
| InChIKey | HXYQMKHRHHXPST-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one?
The IUPAC name of 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one (CID 53184164) is 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one.
What is the SMILES notation for 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one?
The canonical SMILES for 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one is CC1CN=C2C(N3CCN(C(=O)CCc4ccccc4)CC3)=NC=CN21.
What is the InChIKey of 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one?
The InChIKey is HXYQMKHRHHXPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O/c1-16-15-22-20-19(21-9-10-25(16)20)24-13-11-23(12-14-24)18(26)8-7-17-5-3-2-4-6-17/h2-6,9-10,16H,7-8,11-15H2,1H3.
What are the key properties of 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one?
1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one has a molecular weight of 351.45 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-methyl-2,3-dihydroimidazo[1,2-a]pyrazin-8-yl)piperazin-1-yl]-3-phenylpropan-1-one is sourced from PubChem (CID 53184164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).