C23H30N4O3 — CID 53186007
1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-yl-4-pyridinyl)propan-1-one (PubChem CID 53186007) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-yl-4-pyridinyl)propan-1-one.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-yl-4-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 53186007 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-(2-morpholin-4-yl-4-pyridinyl)propan-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)CCc3ccnc(N4CCOCC4)c3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-29-21-5-3-20(4-6-21)25-10-12-27(13-11-25)23(28)7-2-19-8-9-24-22(18-19)26-14-16-30-17-15-26/h3-6,8-9,18H,2,7,10-17H2,1H3 |
| InChIKey | BIXLTAYABBIQDC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|