C23H27N3O2 — CID 53186392
2-(3,4-dimethoxyphenyl)-5-[(2-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine (PubChem CID 53186392) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[(2-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[(2-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 53186392 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[(2-methylphenyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
| SMILES | COc1ccc(-c2cc3n(n2)CCCN(Cc2ccccc2C)C3)cc1OC |
| InChI | InChI=1S/C23H27N3O2/c1-17-7-4-5-8-19(17)15-25-11-6-12-26-20(16-25)14-21(24-26)18-9-10-22(27-2)23(13-18)28-3/h4-5,7-10,13-14H,6,11-12,15-16H2,1-3H3 |
| InChIKey | XMXICUIWTCXAJE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |