About [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone
[3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 53186759) has the molecular formula C18H20N4OS
and a molecular weight of 340.45 g/mol. Its IUPAC name is [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone |
| PubChem CID | 53186759 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CCCc1nc2cccnc2n1C1CCN(C(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C18H20N4OS/c1-2-4-16-20-15-5-3-8-19-17(15)22(16)14-6-9-21(11-14)18(23)13-7-10-24-12-13/h3,5,7-8,10,12,14H,2,4,6,9,11H2,1H3 |
| InChIKey | AJHKQYGDDKWRCK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
The IUPAC name of [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone (CID 53186759) is [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone.
What is the SMILES notation for [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
The canonical SMILES for [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone is CCCc1nc2cccnc2n1C1CCN(C(=O)c2ccsc2)C1.
What is the InChIKey of [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
The InChIKey is AJHKQYGDDKWRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4OS/c1-2-4-16-20-15-5-3-8-19-17(15)22(16)14-6-9-21(11-14)18(23)13-7-10-24-12-13/h3,5,7-8,10,12,14H,2,4,6,9,11H2,1H3.
What are the key properties of [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
[3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone has a molecular weight of 340.45 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-propylimidazo[4,5-b]pyridin-3-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone is sourced from PubChem (CID 53186759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).