C23H29N5OS — CID 53187253
N-[3-(dimethylamino)propyl]-1-(5-phenyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide (PubChem CID 53187253) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-(5-phenyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-(5-phenyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53187253 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-(5-phenyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)piperidine-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCN(c2nc3ccc(-c4ccccc4)nc3s2)CC1 |
| InChI | InChI=1S/C23H29N5OS/c1-27(2)14-6-13-24-21(29)18-11-15-28(16-12-18)23-26-20-10-9-19(25-22(20)30-23)17-7-4-3-5-8-17/h3-5,7-10,18H,6,11-16H2,1-2H3,(H,24,29) |
| InChIKey | ZEZGXTJKRSKWOT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|