C24H31N3O2S — CID 53187983
5-N-(1-benzylpiperidin-4-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide (PubChem CID 53187983) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 5-N-(1-benzylpiperidin-4-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide.
| Compound Name | 5-N-(1-benzylpiperidin-4-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 53187983 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 5-N-(1-benzylpiperidin-4-yl)-2-N,2-N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-2,5-dicarboxamide |
| SMILES | CN(C)C(=O)c1cc2c(s1)CCC(C(=O)NC1CCN(Cc3ccccc3)CC1)C2 |
| InChI | InChI=1S/C24H31N3O2S/c1-26(2)24(29)22-15-19-14-18(8-9-21(19)30-22)23(28)25-20-10-12-27(13-11-20)16-17-6-4-3-5-7-17/h3-7,15,18,20H,8-14,16H2,1-2H3,(H,25,28) |
| InChIKey | MJGHDUQPIPPBRU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |