C21H24F2N4O2S — CID 53188159
2-(4-acetylpiperazin-1-yl)-N-[(3,5-difluorophenyl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 53188159) has the molecular formula C21H24F2N4O2S and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-[(3,5-difluorophenyl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N-[(3,5-difluorophenyl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 53188159 |
| Molecular Formula | C21H24F2N4O2S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-[(3,5-difluorophenyl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(=O)N1CCN(c2nc3c(s2)CC(C(=O)NCc2cc(F)cc(F)c2)CC3)CC1 |
| InChI | InChI=1S/C21H24F2N4O2S/c1-13(28)26-4-6-27(7-5-26)21-25-18-3-2-15(10-19(18)30-21)20(29)24-12-14-8-16(22)11-17(23)9-14/h8-9,11,15H,2-7,10,12H2,1H3,(H,24,29) |
| InChIKey | SBJLHDUFXKKABO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |