C19H19NO3 — CID 5318825
8-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol (PubChem CID 5318825) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 8-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol.
| Compound Name | 8-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol |
|---|---|
| PubChem CID | 5318825 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 8-methoxy-3,3,5-trimethyl-11H-pyrano[3,2-a]carbazol-9-ol |
| SMILES | COc1cc2c(cc1O)[nH]c1c3c(c(C)cc12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C19H19NO3/c1-10-7-13-12-8-16(22-4)15(21)9-14(12)20-17(13)11-5-6-19(2,3)23-18(10)11/h5-9,20-21H,1-4H3 |
| InChIKey | CZZZOTXCAIDYOZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 54.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |