C17H22O4 — CID 5318903
3-hydroxy-5-methoxy-2-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 5318903) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-hydroxy-5-methoxy-2-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-hydroxy-5-methoxy-2-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5318903 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-hydroxy-5-methoxy-2-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | C=C(C)C(CC=C(C)C)CC1=C(O)C(=O)C(OC)=CC1=O |
| InChI | InChI=1S/C17H22O4/c1-10(2)6-7-12(11(3)4)8-13-14(18)9-15(21-5)17(20)16(13)19/h6,9,12,19H,3,7-8H2,1-2,4-5H3 |
| InChIKey | XVWGVTVQZLVSRE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|